BD9968031
(4,5-Difluoro-2-isopropoxyphenyl)boronic acid , 96% , 1072951-61-1
CAS NO.:1072951-61-1
Empirical Formula: C9H11BF2O3
Molecular Weight: 215.99
MDL number: MFCD09265145
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1211.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-79 °C |
| storage temp. | Store at Room Tem. |
| form | solid |
| InChI | 1S/C9H11BF2O3/c1-5(2)15-9-4-8(12)7(11)3-6(9)10(13)14/h3-5,13-14H,1-2H3 |
| InChIKey | RTEYYHDTNPHABZ-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cc(F)c(F)cc1B(O)O |
Description and Uses
4,5-Difluoro-2-isopropoxyphenylboronic acid is a derivative of boronic acid which can activate various DNA cross-linking agents
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






