BD9976247
(S)-Ethyl2-((tert-butyldimethylsilyl)oxy)propanoate , 95% , 106513-42-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB172.00 | In Stock |
|
| 25g | RMB744.00 | In Stock |
|
| 100g | RMB2725.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 187 °C(lit.) |
| Density | 0.875 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 175 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]20/D 30°, c = 1.26 in chloroform |
| InChI | 1S/C11H24O3Si/c1-8-13-10(12)9(2)14-15(6,7)11(3,4)5/h9H,8H2,1-7H3/t9-/m0/s1 |
| InChIKey | KOBAXFIJEBLKRZ-VIFPVBQESA-N |
| SMILES | CCOC(=O)[C@H](C)O[Si](C)(C)C(C)(C)C |
Description and Uses
Precursor to the lactyl-3,4-didehydroproline didemnin B side chain. Starting material for the asymmetric synthesis of syn- and anti- functionalized1,2-diols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids not in Storage Class 3 |






