![1,1'-([1,1'-Biphenyl]-4,4'-diyl)bis(2-bromoethanone)](https://img.chemicalbook.com/CAS/GIF/4072-67-7.gif)
BD9977031
1,1'-([1,1'-Biphenyl]-4,4'-diyl)bis(2-bromoethanone) , 95% , 4072-67-7
CAS NO.：4072-67-7
Empirical Formula: C16H12Br2O2
Molecular Weight: 396.07
MDL number: MFCD00017877
EINECS: 223-785-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB46.40 | In Stock |
|
| 25g | RMB104.00 | In Stock |
|
| 100g | RMB391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-227 °C(Solv: benzene (71-43-2)) |
| Boiling point: | 464.8±30.0 °C(Predicted) |
| Density | 1.622±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C16H12Br2O2/c17-9-15(19)13-5-1-11(2-6-13)12-3-7-14(8-4-12)16(20)10-18/h1-8H,9-10H2 |
| InChIKey | RTSLQVZQORGDQQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(=O)CBr)C=C2)=CC=C(C(=O)CBr)C=C1 |
| EPA Substance Registry System | Ethanone, 1,1'-[1,1'-biphenyl]-4,4'-diylbis[2-bromo- (4072-67-7) |
Description and Uses
4,4'-Bis(2-bromoacetyl)biphenyl is an intermediate in laboratory research and development.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| HS Code | 29147000 |
