BD9979231
3-Acetylphenyl ethyl(methyl)carbamate , 98% , 855300-09-3
Synonym(s):
N-Ethyl-N-methylcarbamic acid 3-acetylphenyl ester;3-Acetylphenyl ethyl(methyl)carbamate
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB129.60 | In Stock |
|
| 250mg | RMB200.00 | In Stock |
|
| 1g | RMB494.40 | In Stock |
|
| 5g | RMB2056.80 | In Stock |
|
| 10g | RMB3278.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 337℃ |
| Density | 1.112 |
| Flash point: | 158℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Chloroform (Slightly) |
| form | Oil |
| pka | -1.56±0.70(Predicted) |
| color | Colourless |
| Major Application | pharmaceutical |
| InChI | 1S/C12H15NO3/c1-4-13(3)12(15)16-11-7-5-6-10(8-11)9(2)14/h5-8H,4H2,1-3H3 |
| InChIKey | ABNQSLSOFYAGHU-UHFFFAOYSA-N |
| SMILES | N(CC)(C)C(=O)Oc1cc(ccc1)C(=O)C |
Description and Uses
Des [3-(1-dimethylamino)ethyl] 3-acetyl Rivastigmine (Rivastigmine EP Impurity C) is a derivative of Rivastigmine (Tartrate: R541000), and acetylcholinesterase inhibitor that is commonly used to treat dementia associated with Parkinson’s disease and Alzheimer’s disease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |







