BD9996931
5-(3-(Dimethylamino)propyl)-5H-dibenzo[a,d][7]annulen-5-ol , 97% , 18029-54-4
CAS NO.:18029-54-4
Empirical Formula: C20H23NO
Molecular Weight: 293.4
MDL number:
EINECS: 241-944-5
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB787.20 | In Stock |
|
| 100mg | RMB1180.80 | In Stock |
|
| 250mg | RMB1771.20 | In Stock |
|
| 1g | RMB4428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-140℃ |
| Boiling point: | 443.0±33.0 °C(Predicted) |
| Density | 1.099 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.36±0.20(Predicted) |
| color | Off-White to Light Beige |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C20H23NO/c1-21(2)15-7-14-20(22)18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)20/h3-6,8-13,22H,7,14-15H2,1-2H3 |
| InChIKey | VMLRQKQUOMJJAN-UHFFFAOYSA-N |
| SMILES | N(CCCC1(c2c(cccc2)C=Cc3c1cccc3)O)(C)C |
Description and Uses
5-Hydroxy-N-methylprotriptyline acts as a reducing agent in chemical reactions. Cyclobenzaprine USP Related Compound A.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2921490002 |
| Storage Class | 11 - Combustible Solids |

![5-(3-(Dimethylamino)propyl)-5H-dibenzo[a,d][7]annulen-5-ol](https://img.chemicalbook.com/CAS/GIF/18029-54-4.gif)


![5-[3-(Dimethylamino)propylidene]-5H-dibenzo[a,d]cyclohepten-3-ol](https://img.chemicalbook.com/CAS/GIF/30235-48-4.gif)
