F024623
Ethyl 3,5-dinitrobenzoate , 98 , 618-71-3
CAS NO.:618-71-3
Empirical Formula: C9H8N2O6
Molecular Weight: 240.17
MDL number: MFCD00007232
EINECS: 210-559-4
| Pack Size | Price | Stock | Quantity |
| 50g | RMB587.20 | In Stock |
|
| 250g | RMB2212.00 | In Stock |
|
| 1000g | RMB3364.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-95 °C (lit.) |
| Boiling point: | 382.88°C (rough estimate) |
| Density | 1.2950 |
| refractive index | 1.5600 (estimate) |
| storage temp. | Store at room temperature |
| form | solid |
| Appearance | White to off-white Solid |
| BRN | 1995473 |
| InChI | 1S/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
| InChIKey | IBQREHJPMPCXQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 618-71-3(CAS DataBase Reference) |
Description and Uses
Ethyl 3,5-dinitrobenzoate forms charge transfer spectra with n-alkane solutions containing hexakis(n-hexyloxy)triphenylene. Nuclear magnetic resonance spectra of ethyl 3,5-dinitrobenzoate was studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P262 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






![[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-dinitrobenzoate](https://img.chemicalbook.com/CAS/GIF/25279-63-4.gif)