PRODUCT Properties
| Melting point: | −130 °C(lit.) |
| Boiling point: | 36 °C(lit.) |
| Density | 0.731 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | <−30 °F |
| solubility | Chloroform (Sparingly), Hexane (Slightly) |
| form | Liquid |
| Sensitive | Light Sensitive |
| Stability: | Volatile |
| InChI | 1S/C5H12/c1-3-5-4-2/h3-5H2,1-2H3/i1D3,2D3,3D2,4D2,5D2 |
| InChIKey | OFBQJSOFQDEBGM-HYVJACIRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 2031-90-5 |
| CAS Number Unlabeled | 109-66-0 |
Description and Uses
Pentane-d12 is a deuterated NMR solvent useful in NMR-based research and analyses.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H336 |
| Precautionary statements | P210-P233-P240-P241-P301+P310-P331 |
| target organs | Central nervous system |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 9-16-29-33 |
| RIDADR | UN 1265 3/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Asp. Tox. 1 Flam. Liq. 2 STOT SE 3 |
