F185022
Cyclohexanone 2,4-dinitrophenylhydrazone , 99 , 1589-62-4
CAS NO.：1589-62-4
Empirical Formula: C12H14N4O4
Molecular Weight: 278.26
MDL number: MFCD00001658
EINECS: 216-458-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB282.40 | In Stock |
|
| 5g | RMB1038.40 | In Stock |
|
| 25g | RMB5035.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Boiling point: | 421.08°C (rough estimate) |
| Density | 1.2764 (rough estimate) |
| refractive index | 1.6081 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | chloroform: 25mg/mL, clear, orange |
| form | powder or crystals |
| pka | 14.29±0.20(Predicted) |
| Appearance | White to yellow Solid |
| Water Solubility | Soluble in water (partly). |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
| InChIKey | QLWXZRVOHCYKKK-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(N\N=C2\CCCCC2)c(c1)[N+]([O-])=O |
Description and Uses
Cyclohexanone 2,4-dinitrophenylhydrazone is a useful standard for elemental analysis. Also used as a pharmaceutical intermediate.
Safety
| Hazard Codes | F,T,Xn |
| Risk Statements | 11-20/21/22-36-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
