A1429412
Butyraldehyde 2,4-Dinitrophenylhydrazone , ≥96.0%(HPLC) , 1527-98-6
Synonym(s):
Butyraldehyde-2,4-dinitrophenylhydrazone;Butyraldehyde-2,4-dinitrophenylhydrazone solution;Butyraldehyde-2,4-DNPH solution
CAS NO.:1527-98-6
Empirical Formula: C10H12N4O4
Molecular Weight: 252.23
MDL number: MFCD00191327
EINECS: 625-638-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB285.60 | In Stock |
|
| 5G | RMB796.00 | In Stock |
|
| 10G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 401.8±45.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol (Sparingly) |
| pka | 12.29±0.10(Predicted) |
| color | Pale Yellow to Light Brown |
| Stability: | Hygrscopic |
| Major Application | environmental |
| InChI | 1S/C10H12N4O4/c1-2-3-6-11-12-9-5-4-8(13(15)16)7-10(9)14(17)18/h4-7,12H,2-3H2,1H3/b11-6+ |
| InChIKey | IKGRHEWIFBFXPP-IZZDOVSWSA-N |
| SMILES | CCC/C=N/NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 1527-98-6 |
Description and Uses
Butyraldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-36-20/21/22-11 |
| Safety Statements | 26-36/37-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| HS Code | 2928.00.5000 |
| HazardClass | 4.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






