PRODUCT Properties
| Melting point: | 196-197 °C(lit.) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| Major Application | environmental |
| InChI | 1S/C17H16N8O8/c26-22(27)12-4-6-14(16(10-12)24(30)31)20-18-8-2-1-3-9-19-21-15-7-5-13(23(28)29)11-17(15)25(32)33/h4-11,20-21H,1-3H2/b18-8-,19-9+ |
| InChIKey | QAUJHIMXYLFORD-NCEWWTOFSA-N |
| SMILES | [O-][N+](=O)c1ccc(N\N=C\CCC\C=N/Nc2ccc(cc2[N+]([O-])=O)[N+]([O-])=O)c(c1)[N+]([O-])=O |
Description and Uses
Glutaraldehyde 2,4-dinitrophenylhydrazone is an analytical standard for environmental analysis. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-36-20/21/22-11 |
| Safety Statements | 26-36-16-36/37 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
