F185122
Tris(dimethylamino)aluminum dimer , Null , 32093-39-3
Synonym(s):
Hexakis(dimethylamido)dialuminum;Tris(dimethylamino)alane dimer
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3878.40 | In Stock |
|
| 5g | RMB10240.00 | In Stock |
|
| 25g | RMB22054.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C(lit.) |
| Boiling point: | 90℃/0.05mm subl. |
| Density | 0.865 g/mL at 25 °C(lit.) |
| Flash point: | 70 °F |
| form | Powder |
| color | white to yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/6C2H6N.2Al/c6*1-3-2;;/h6*1-2H3;;/q6*-1;2*+3 |
| InChIKey | JGZUJELGSMSOID-UHFFFAOYSA-N |
| SMILES | CN(C)[Al](N(C)C)N(C)C.CN(C)[Al](N(C)C)N(C)C |
Description and Uses
Preparation of aluminum nitrides
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H260-H314 |
| Precautionary statements | P223-P231+P232-P280-P305+P351+P338-P370+P378-P422 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C |
| Risk Statements | 11-14/15-34 |
| Safety Statements | 16-26-36/37/39-43 |
| RIDADR | UN 3131 4.3/PG 1 |
| WGK Germany | 3 |
| HazardClass | 4.3 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Skin Corr. 1B Water-react 1 |







