F198923
Tetrakis(diethylamino)titanium(IV) , 99.99 , 4419-47-0
Synonym(s):
TDEAT;Tetrakis(diethylamino)titanium;Tetrakis(diethylamino)titanium(IV);Titanium(IV) tetrakis(diethylamide)
| Pack Size | Price | Stock | Quantity |
| 2g | RMB564.80 | In Stock |
|
| 10g | RMB2254.40 | In Stock |
|
| 50g | RMB8965.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 4 °C |
| Boiling point: | 112 °C0.1 mm Hg(lit.) |
| Density | 0.931 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | -18 °F |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Reacts with air. |
| form | liquid |
| color | yellow to orange |
| Specific Gravity | 0.95 |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3621431 |
| InChI | 1S/4C4H10N.Ti/c4*1-3-5-4-2;/h4*3-4H2,1-2H3;/q4*-1;+4 |
| InChIKey | VJDVOZLYDLHLSM-UHFFFAOYSA-N |
| SMILES | CCN(CC)[Ti](N(CC)CC)(N(CC)CC)N(CC)CC |
| CAS DataBase Reference | 4419-47-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrakis(diethylamino)titanium(4419-47-0) |
| EPA Substance Registry System | Ethanamine, N-ethyl-, titanium(4+) salt (4419-47-0) |
Description and Uses
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H260-H314 |
| Precautionary statements | P210-P223-P231+P232-P280-P370+P378-P422 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,C,Xi |
| Risk Statements | 11-14/15-34-36/37/38 |
| Safety Statements | 26-36/37/39-43-45-37/39-16 |
| RIDADR | UN 3398 4.3/PG 1 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2921 19 50 |
| HazardClass | 4.3 |
| PackingGroup | II |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B Water-react 1 |
| REACH Registrations | Inactive |
