PRODUCT Properties
| Boiling point: | 489.1℃[at 101 325 Pa] |
| Density | 1,01 g/cm3 |
| Flash point: | 110°C |
| form | liquid |
| Specific Gravity | 1.01 |
| color | green, viscous |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | NIOSH: IDLH 25 mg/m3; TWA 0.5 mg/m3 |
| InChI | InChI=1S/C8H16O2.Cr/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); |
| InChIKey | NPCUWXDZFXSRLT-UHFFFAOYSA-N |
| SMILES | C(CC)(C(=O)O)CCCC.[Cr] |
| LogP | 7.64 |
| EPA Substance Registry System | Chromium(III) 2-ethylhexanoate (3444-17-5) |
Description and Uses
Chromium(III) 2-ethylhexanoate is used in paints, coatings and petrochemical manufacturing.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H225-H304-H333-H335-H336-H400-H410-H315-H319-H361 |
| Precautionary statements | P210-P301+P310a-P303+P361+P353-P405-P501a-P280h-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HazardClass | 3 |








