F225122
4-Acetamidoantipyrine , 97 , 83-15-8
Synonym(s):
N-(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)acetamide;N-Antipyrinylacetamide;4-Acetylaminophenazone;NSC 331807
CAS NO.:83-15-8
Empirical Formula: C13H15N3O2
Molecular Weight: 245.28
MDL number: MFCD00003141
EINECS: 201-457-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB414.40 | In Stock |
|
| 25g | RMB855.20 | In Stock |
|
| 100g | RMB2951.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-203 °C(lit.) |
| Boiling point: | 388.24°C (rough estimate) |
| Density | 1.1477 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.84±0.20(Predicted) |
| color | White to Off-White |
| BRN | 234585 |
| Major Application | pharmaceutical |
| InChI | 1S/C13H15N3O2/c1-9-12(14-10(2)17)13(18)16(15(9)3)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,14,17) |
| InChIKey | OIAGWXKSCXPNNZ-UHFFFAOYSA-N |
| SMILES | CN1N(C(=O)C(NC(C)=O)=C1C)c2ccccc2 |
| CAS DataBase Reference | 83-15-8(CAS DataBase Reference) |
Description and Uses
A labelled metabolite of Metamizol. Metabolism of Metamizol in early stages of the incubated hen's egg.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |






![[2-DIMETHYLAMINOPROPIONAMIDO]ANTIPYRINE](https://img.chemicalbook.com/CAS/GIF/3690-04-8.gif)