PRODUCT Properties
| Melting point: | 200°C |
| Boiling point: | 500°C (rough estimate) |
| Density | 1.3553 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Aqueous Acid (Slightly, Heated, Sonicated), Aqueous Base (Slightly, Sonicated) |
| pka | -1.11±0.42(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C7H9NO3S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-4H,8H2,1H3,(H,9,10,11) |
| InChIKey | BRKFTWHPLMMNHF-UHFFFAOYSA-N |
| SMILES | C1(S(O)(=O)=O)=CC(N)=CC=C1C |
| Dissociation constant | 0-0 at 23℃ |
| CAS DataBase Reference | 118-88-7(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Amino-o-toluenesulfonic acid (118-88-7) |
Description and Uses
4-Amino-2-sulfotoluene can be used to treat bacterial infections.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2585 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
