PRODUCT Properties
| Melting point: | -20°C |
| Boiling point: | 215°C |
| Density | 2,03 g/cm3 |
| refractive index | 1.3348 |
| Flash point: | None |
| storage temp. | Store at room temperature |
| form | liquid |
| Specific Gravity | 2.03 |
| color | Clear, colourless |
| Water Solubility | Immiscible with water. |
| BRN | 2514226 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING SOLVENT |
| InChI | 1S/C14F24/c15-1-2(16)4(18,10(29,30)14(37,38)12(33,34)6(2,21)22)8(25,26)7(23,24)3(1,17)9(27,28)13(35,36)11(31,32)5(1,19)20 |
| InChIKey | QKENRHXGDUPTEM-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(C1(F)F)C(F)(F)C(F)(F)C3(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C23F |
| LogP | 8.410 (est) |
| CAS DataBase Reference | 306-91-2(CAS DataBase Reference) |
| EPA Substance Registry System | Phenanthrene, tetracosafluorotetradecahydro- (306-91-2) |
Description and Uses
Perfluoro(tetradecahydrophenanthrene) is used as a solvent in the preparation of co polymers obtained from emulsion polymerization of 2,3,3,3-tetrafluoroethylene and tetrafluoroethylene (TFE).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2903898090 |
| Storage Class | 10 - Combustible liquids |



