F302621
Methyl 4'-chlorobiphenyl-4-carboxylate , 95 , 89901-02-0
Synonym(s):
4′-Chlorobiphenyl-4-carboxylic acid methyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB916.00 | In Stock |
|
| 5g | RMB3473.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115°C |
| Boiling point: | 364.1±25.0 °C(Predicted) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| form | solid |
| InChI | 1S/C14H11ClO2/c1-17-14(16)12-4-2-10(3-5-12)11-6-8-13(15)9-7-11/h2-9H,1H3 |
| InChIKey | UJIUMBFXWGXMOV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)-c2ccc(Cl)cc2 |
| CAS DataBase Reference | 89901-02-0 |
Description and Uses
Methyl 4-(4-Chlorophenyl)benzoate is used in the preparation of ionic compound-supported palladium complex as catalyst for suzuki-Miyaura coupling of aryl halides.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
