F312122
Chlorodi(o-tolyl)phosphine , 98 , 36042-94-1
Synonym(s):
Bis(2-methylphenyl)phosphinous chloride;Chlorobis(2-methylphenyl)phosphine;Chlorobis(o-tolyl)phosphine;Di(o-methylphenyl)phosphine chloride;Di-o-tolylchlorophosphine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB949.60 | In Stock |
|
| 5g | RMB7868.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57°C |
| Boiling point: | 174-178°C/3mm |
| Flash point: | 174-178°C/3mm |
| storage temp. | 2-8°C |
| form | liquid |
| color | white to yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C14H14ClP/c1-11-7-3-5-9-13(11)16(15)14-10-6-4-8-12(14)2/h3-10H,1-2H3 |
| InChIKey | KAAGXBGJRWFWPT-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CC=C1C)(C1=CC=CC=C1C)Cl |
Description and Uses
Chlorodi(o-tolyl)phosphine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dye stuff.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C |
| Risk Statements | 17-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2845 4.2/PG 1 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






