F312922
DL-^a-(Methylaminomethyl)benzyl alcohol , 99 , 6589-55-5
Synonym(s):
Halostachine
CAS NO.:6589-55-5
Empirical Formula: C9H13NO
Molecular Weight: 151.21
MDL number: MFCD00004506
EINECS: 229-525-5
| Pack Size | Price | Stock | Quantity |
| 2g | RMB331.20 | In Stock |
|
| 10g | RMB1198.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C (lit.) |
| Boiling point: | 132-133 °C(Press: 15 Torr) |
| Density | 1.02 g/cm3(Temp: 0 °C) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Needles |
| pka | 14.03±0.20(Predicted) |
| color | White |
| Merck | 14,4601 |
| BRN | 1072841 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. |
| InChI | InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3 |
| InChIKey | ZCTYHONEGJTYQV-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(O)CNC |
Description and Uses
α-(Methylaminomethyl)benzyl alcohol was used in the synthesis of 1,4-disubstituted-2,3,4,5-tetrahydro-1H-3-benzazepines. It was also used as internal standard during determination of pseudoephedrine and phenylpropanolamine urine concentrations by HPLC.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332 |
| Precautionary statements | P261-P264-P270-P271-P301+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | DO9625000 |
| HS Code | 29221985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |







