F402129
Vanadium(IV) oxide phthalocyanine , Null , 13930-88-6
Synonym(s):
Oxo[29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]vanadium;Vanadium(IV)phthalocyanine oxide;Xerox xpp-VOPc
CAS NO.:13930-88-6
Empirical Formula: C32H16N8OV
Molecular Weight: 579.48
MDL number: MFCD00041966
EINECS: 237-700-2
| Pack Size | Price | Stock | Quantity |
| 0.5g | RMB373.60 | In Stock |
|
| 2g | RMB1253.60 | In Stock |
|
| 10g | RMB4879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| form | Crystalline Powder or Crystals and Chunks |
| color | White |
| Water Solubility | Insoluble in water. |
| λmax | 701 nm |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| InChIKey | YRZZLAGRKZIJJI-UHFFFAOYSA-N |
| SMILES | O=[V]1N(/C(C2=C/3C=CC=C2)=N\C4=N/C(C5=C4C=CC=C5)=N\6)C3=N/C(C7=C/8C=CC=C7)=NC8=N/C9=C%10C(C=CC=C%10)=C6N91 |
| EPA Substance Registry System | Vanadium, oxo[29H,31H-phthalocyaninato(2-)-.kappa.N29,.kappa.N30,.kappa.N31,.kappa.N32]-, (SP-5-12)- (13930-88-6) |
Description and Uses
It is used as an organic light-emitting diode intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-26 |
| RIDADR | UN3285 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





