F415123
1-n-Heptyl-4-(4-pyridyl)pyridinium bromide , 95 , 39127-10-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB683.20 | In Stock |
|
| 5g | RMB2384.00 | In Stock |
|
| 25g | RMB8336.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-128 °C(lit.) |
| storage temp. | room temp |
| form | Powder |
| color | White to yellow |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C17H23N2.BrH/c1-2-3-4-5-6-13-19-14-9-17(10-15-19)16-7-11-18-12-8-16;/h7-12,14-15H,2-6,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | GBJHAEPTEZMDHU-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCCC[n+]1ccc(cc1)-c2ccncc2 |
Description and Uses
1-Heptyl-4-(4-pyridyl)pyridinium Bromide is a dye/stain. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![1,1'-Diheptyl-4,4'-bipyridinium Dibromide [for Electrochromic Material]](https://img.chemicalbook.com/CAS/GIF/6159-05-3.gif)