PRODUCT Properties
| Boiling point: | 36 °C (11 mmHg) |
| Density | 1.416 g/mL at 25 °C |
| refractive index | 1.458-1.46 |
| Flash point: | >100°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | Miscible with dichloromethane. |
| form | Liquid |
| color | Clear light yellow to brown |
| BRN | 906773 |
| InChI | InChI=1S/C4H7BrO/c1-3(5)4(2)6/h3H,1-2H3 |
| InChIKey | BNBOUFHCTIFWHN-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Br)C |
| CAS DataBase Reference | 814-75-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butanone, 3-bromo- (814-75-5) |
Description and Uses
3-Bromo-2-butanone is involved in the preparation of o-isopropyl S-3-oxobutan-2-yl dithiocarbonate by reaction with potassium o-isopropylxanthate, which on treatment with sulfuric acid gives 4,5-dimethyl-1,3-dithiol-2-one .
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302+H312-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,C |
| Risk Statements | 36/37/38-20/21/22-34-21/24-21/22 |
| Safety Statements | 36/37/39-26-45 |
| RIDADR | 1224 |
| WGK Germany | 2 |
| RTECS | EL7005000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |









