PRODUCT Properties
| Melting point: | 262 °C (decomp) |
| storage temp. | room temp |
| form | Powder |
| color | Yellow to dark green |
| λmax | 424 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C19H19N2S2.HI/c1-3-20-14-9-5-7-11-16(14)22-18(20)13-19-21(4-2)15-10-6-8-12-17(15)23-19;/h5-13H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XWUVSDMFUQTKQC-UHFFFAOYSA-M |
| SMILES | [I-].CCN1\C(Sc2ccccc12)=C\c3sc4ccccc4[n+]3CC |
| EPA Substance Registry System | Benzothiazolium, 3-ethyl-2-[(3-ethyl-2(3H)-benzothiazolylidene)methyl]-, iodide (2197-01-5) |
Description and Uses
3,3μ-Diethylthiacyanine iodide has been used to investigate the kinetics of fluorescence staining in bacteria (two Gram-negative and two Gram-positive species).
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H331-H315-H311-H301-H335-H319 |
| Precautionary statements | P280-P302+P352-P312-P322-P361-P363-P405-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P310-P321-P330-P405-P501-P261-P271-P304+P340-P311-P321-P403+P233-P405-P501 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
