F515321
(R)-(+)-3-(Benzyloxycarbonyl)oxazolidine-4-carboxylic acid , Null , 97534-84-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB729.60 | In Stock |
|
| 5g | RMB2398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-74 °C(lit.) |
| alpha | +92°(20℃, c=1, CHCl3) |
| Boiling point: | 454.8±45.0 °C(Predicted) |
| Density | 1.385 |
| pka | 3.51±0.20(Predicted) |
| form | solid |
| optical activity | [α]20/D +92°, c = 1 in chloroform |
| InChI | InChI=1S/C12H13NO5/c14-11(15)10-7-17-8-13(10)12(16)18-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | XRRRGBIMHQARMF-SNVBAGLBSA-N |
| SMILES | O1C[C@H](C(O)=O)N(C(OCC2=CC=CC=C2)=O)C1 |
| CAS DataBase Reference | 97534-84-4 |
Description and Uses
Useful chiral synthon (derived from serine) for the asymmetric synthesis of a variety of nitrogen-containing targets.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
| WGK Germany | 3 |
| HS Code | 29349990 |
