F521529
Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate , Null , 307511-65-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB955.20 | In Stock |
|
| 1g | RMB2637.60 | In Stock |
|
| 5g | RMB8833.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-83℃ |
| Boiling point: | 411.5±45.0 °C(Predicted) |
| Density | 1.179±0.06 g/cm3(Predicted) |
| pka | -0.04±0.14(Predicted) |
| form | solid |
| InChI | 1S/C15H17NO2S/c1-4-18-15(17)13-12(8-19-14(13)16)11-6-5-9(2)10(3)7-11/h5-8H,4,16H2,1-3H3 |
| InChIKey | KLIHUUITIBDJMQ-UHFFFAOYSA-N |
| SMILES | [s]1c(c(c(c1)c2cc(c(cc2)C)C)C(=O)OCC)N |
| CAS DataBase Reference | 307511-65-5 |
Description and Uses
Ethyl 2-Amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate is a useful reagent for synthesis and evaluation of substituted (thieno[2,3-d]pyrimidin-4-ylthio)carboxylic acids as inhibitors of human protein kinase CK2.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |






