PRODUCT Properties
| Melting point: | 52-56 °C |
| Boiling point: | 138-140°C 2mm |
| Density | 0.974±0.06 g/cm3(Predicted) |
| pka | 9.16±0.10(Predicted) |
| form | Solid |
| color | Off-white to pale yellow |
| Sensitive | Air Sensitive |
| InChI | 1S/C15H24N2/c1-15(2,3)14-6-4-13(5-7-14)12-17-10-8-16-9-11-17/h4-7,16H,8-12H2,1-3H3 |
| InChIKey | UQLCETYSARZZSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(CN2CCNCC2)cc1 |
| CAS DataBase Reference | 956-61-6(CAS DataBase Reference) |
Description and Uses
1-(4-TERT-BUTYLBENZYL)PIPERAZINE can be used as a crucial intermediate in the synthesis of various pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
