PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 123 °C/20 mmHg (lit.) |
| Density | 0.949 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | Not miscible. |
| form | Liquid |
| Specific Gravity | 0.92 |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/C12H28Ge/c1-4-7-10-13(11-8-5-2)12-9-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | KTSWILXIWHVQLR-UHFFFAOYSA-N |
| SMILES | [GeH](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 998-39-0(CAS DataBase Reference) |
Description and Uses
Tri-n-butylgermanium hydride is used in the reduction of benzylic chlorides. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H318 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-41 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 |







