F590121
(S)-(+)-2-Dibenzylamino-3-phenyl-1-propanol , 99 , 111060-52-7
Synonym(s):
N,N-Dibenzyl-L -phenylalaninol
| Pack Size | Price | Stock | Quantity |
| 1g | RMB336.00 | In Stock |
|
| 5g | RMB1105.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-74 °C (lit.) |
| Boiling point: | 488.0±33.0 °C(Predicted) |
| Density | 1.111±0.06 g/cm3(Predicted) |
| pka | 14.67±0.10(Predicted) |
| form | solid |
| optical activity | [α]20/D +8.0°, c = 4 in methanol |
| BRN | 7253058 |
| InChI | 1S/C23H25NO/c25-19-23(16-20-10-4-1-5-11-20)24(17-21-12-6-2-7-13-21)18-22-14-8-3-9-15-22/h1-15,23,25H,16-19H2/t23-/m0/s1 |
| InChIKey | ZXNVOFMPUPOZDF-QHCPKHFHSA-N |
| SMILES | OC[C@H](Cc1ccccc1)N(Cc2ccccc2)Cc3ccccc3 |
| CAS DataBase Reference | 111060-52-7(CAS DataBase Reference) |
Description and Uses
Building block for the synthesis of HIV protease inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






