PRODUCT Properties
| Melting point: | 194-195℃ |
| Boiling point: | 241.2±9.0℃ (760 Torr) |
| Density | 1.12±0.1 g/cm3 (20 ºC 760 Torr) |
| vapor pressure | 0.1±0.5 mmHg at 25°C |
| refractive index | 1.529 |
| Flash point: | 86.5±4.5℃ |
| InChI | InChI=1S/C10H15Cl/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 |
| InChIKey | DPCLLPAHJSYBTE-UHFFFAOYSA-N |
| SMILES | C12CC3CC(CC(C3)C1Cl)C2 |
| CAS DataBase Reference | 7346-41-0(CAS DataBase Reference) |
Description and Uses
2-Chloroadamantane is an organic compound used mainly as a reaction reagent in chemical and experimental research.





