F601923
Aurintricarboxylic acid , Null , 4431-00-9
Synonym(s):
ATA;Aurintricarboxylic Acid - CAS 4431-00-9 - Calbiochem
CAS NO.：4431-00-9
Empirical Formula: C22H14O9
Molecular Weight: 422.34
MDL number: MFCD00011663
EINECS: 224-628-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB509.60 | In Stock |
|
| 25g | RMB1801.60 | In Stock |
|
| 100g | RMB5336.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C(lit.) |
| Boiling point: | 458.99°C (rough estimate) |
| Density | 1.3860 (rough estimate) |
| refractive index | 1.6230 (estimate) |
| storage temp. | +15C to +30C |
| solubility | 1 M NH4OH: 10 mg/mL |
| pka | 2.20±0.20(Predicted) |
| form | powder |
| color | dark red to brown |
| Water Solubility | Insoluble in water. |
| BRN | 2228904 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C22H14O9/c23-16-4-1-10(7-13(16)20(26)27)19(11-2-5-17(24)14(8-11)21(28)29)12-3-6-18(25)15(9-12)22(30)31/h1-9,23-24H,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | GIXWDMTZECRIJT-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(ccc1O)C(\c2ccc(O)c(c2)C(O)=O)=C3\C=CC(=O)C(=C3)C(O)=O |
| CAS DataBase Reference | 4431-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 5-[(3-carboxy-4-hydroxyphenyl)(3-carboxy-4-oxo-2,5-cyclohexadien-1-ylidene)methyl]-2-hydroxy- (4431-00-9) |
Description and Uses
endonuclease inhibitor; apoptosis inhibitor, topoisomerase II inhibitor
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU4790000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
