F634029
3-(2-Aminoethyl)-5-methylindole hydrochloride , 97 , 1010-95-3
Synonym(s):
3-(2-Aminoethyl)-5-methylindole hydrochloride
CAS NO.:1010-95-3
Empirical Formula: C11H15ClN2
Molecular Weight: 210.7
MDL number: MFCD00012683
EINECS: 213-777-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1712.80 | In Stock |
|
| 25g | RMB4320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290-292 °C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | Pale Beige to Light Tan |
| Water Solubility | H2O: soluble 50mg/mL, clear, yellow |
| Sensitive | Hygroscopic |
| InChI | 1S/C11H14N2.ClH/c1-8-2-3-11-10(6-8)9(4-5-12)7-13-11;/h2-3,6-7,13H,4-5,12H2,1H3;1H |
| InChIKey | RBHDFGBPJGEYCK-UHFFFAOYSA-N |
| SMILES | Cl.Cc1ccc2[nH]cc(CCN)c2c1 |
| CAS DataBase Reference | 1010-95-3 |
Description and Uses
- reactant in synthesis of kinesin spindle protein (KSP) inhibitors
- reactant in intramolecular furan Diels-Alder reactions
- reactant in Pictet-Spengler-like reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 22-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| Storage Class | 11 - Combustible Solids |






