F675122
3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid , 97 , 564-10-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB762.40 | In Stock |
|
| 5g | RMB2624.80 | In Stock |
|
| 25g | RMB10495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-53 °C (lit.) |
| Boiling point: | 125/750mm |
| Density | 1.602±0.06 g/cm3(Predicted) |
| pka | 1.53±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | 1S/C4H2F6O2/c5-3(6,7)1(2(11)12)4(8,9)10/h1H,(H,11,12) |
| InChIKey | RAEAYTICAPHWJW-UHFFFAOYSA-N |
| SMILES | OC(=O)C(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 564-10-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Perfluoroisobutyric acid (564-10-3) |
Description and Uses
The behavior of 3,3,3-trifluoro-2-(trifluoromethyl)propionic acid was studied using ion-exclusion chromatography.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | CORROSIVE |
| HS Code | 29159000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
