F721321
(E)-1-Pentene-1,2-diboronic acid bis(pinacol) ester , 98 , 307531-75-5
Synonym(s):
1-[cis-1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)] pentene;2,2′-[(1Z)-1-Propyl-1,2-ethenediyl]bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]
CAS NO.：307531-75-5
Empirical Formula: C17H32B2O4
Molecular Weight: 322.06
MDL number: MFCD03453052
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB972.80 | In Stock |
|
| 5g | RMB4040.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 301-303 |
| Boiling point: | 301-303 °C(lit.) |
| Density | 0.954 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 169 °F |
| InChI | 1S/C17H32B2O4/c1-10-11-13(19-22-16(6,7)17(8,9)23-19)12-18-20-14(2,3)15(4,5)21-18/h12H,10-11H2,1-9H3/b13-12- |
| InChIKey | MXQDNQSRLNMUOP-SEYXRHQNSA-N |
| SMILES | CCC\C(=C\B1OC(C)(C)C(C)(C)O1)B2OC(C)(C)C(C)(C)O2 |
Description and Uses
(E)-1-Pentene-1,2-diboronic acid bis(pinacol) ester can be used as a reactant in the stereoselective synthesis of γ-boryl substituted homoallylic alcohols by reacting with aromatic aldehydes via Ru-catalyzed double bond transposition reaction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| Storage Class | 10 - Combustible liquids not in Storage Class 3 |
