F731021
Rhodanile Blue , Null , 14969-56-3
CAS NO.：14969-56-3
Empirical Formula: C48H50ClN5O3
Molecular Weight: 780.4
MDL number: MFCD00011937
EINECS: 239-040-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB676.00 | In Stock |
|
| 5g | RMB1940.00 | In Stock |
|
| 25g | RMB8243.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | room temp |
| form | powder or crystals |
| λmax | 552 nm 630 nm (2nd) |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | UYQVPCFMVWEDCA-HAIIBULWSA-M |
| SMILES | [Cl-].CCN(CC)c1ccc2N=C3C(Oc2c1)=CC(=N/C(=O)c4ccccc4C5=C6C=C\C(C=C6Oc7cc(ccc57)N(CC)CC)=[N+](\CC)CC)\c8ccccc38 |
Description and Uses
Complex of Rhodamine B and Nile Blue.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H319-H351 |
| Precautionary statements | P201-P280-P305+P351+P338-P308+P313-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 26-36/37/39-36-22 |
| RIDADR | 3143 |
| WGK Germany | 3 |
| RTECS | BP6700000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
