F737621
Ethylene glycol-d{6} , 98 , 15054-86-1
CAS NO.：15054-86-1
Empirical Formula: C2H6O2
Molecular Weight: 62.07
MDL number: MFCD00002885
EINECS: 239-122-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3783.20 | In Stock |
|
| 5g | RMB23904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −13 °C(lit.) |
| Boiling point: | 196-198 °C(lit.) |
| Density | 1.113 g/mL at 25 °C(lit.) |
| vapor density | 2.1 (vs air) |
| vapor pressure | 0.08 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Warer (Slightly) |
| form | Liquid |
| color | blue |
| Water Solubility | Soluble in water, methanol, DMSO |
| Dielectric constant | 37.7（25℃） |
| Stability: | Hygroscopic |
| InChI | 1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2,3D,4D |
| InChIKey | LYCAIKOWRPUZTN-UFSLNRCZSA-N |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])O[2H] |
| CAS DataBase Reference | 15054-86-1(CAS DataBase Reference) |
| CAS Number Unlabeled | 107-21-1 |
Description and Uses
Ethylene glycol-d6 may be used as starting material for the synthesis of oxiran-d4.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| target organs | Kidney |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-36-24/25 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 1 |
| RTECS | KW2975000 |
| F | 3 |
| HS Code | 28459000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral STOT RE 2 Oral |
