PRODUCT Properties
| Melting point: | 280 °C (dec.)(lit.) |
| storage temp. | room temp |
| form | powder or crystals |
| ε(extinction coefficient) | ≥75000 at 588-596nm in ethanol at 0.003g/L |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C23H23N2.HI/c1-3-24-15-13-18(20-9-5-7-11-22(20)24)17-19-14-16-25(4-2)23-12-8-6-10-21(19)23;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BFVPXROCOCTNOP-UHFFFAOYSA-M |
| SMILES | [I-].CCN1C=CC(=Cc2cc[n+](CC)c3ccccc23)c4ccccc14 |
| CAS DataBase Reference | 4727-49-5 |
Description and Uses
1,1′-Diethyl-4,4′-cyanine Iodide is a quinocyanine dye.,1′-Diethyl-4,4′-cyanine Iodide is widely used as a photographic sensitizing dye. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
