F777122
Methyl 3,5-dibromo-2-hydroxybenzoate , 98 , 21702-79-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB988.00 | In Stock |
|
| 100g | RMB3162.40 | In Stock |
|
| 500g | RMB12865.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-156 °C |
| Density | 1.9544 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C8H6Br2O3/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3,11H,1H3 |
| InChIKey | KISQISIKTRRMOX-UHFFFAOYSA-N |
| SMILES | COC(C1=C(C(Br)=CC(Br)=C1)O)=O |
| CAS DataBase Reference | 21702-79-4(CAS DataBase Reference) |
Description and Uses
Methyl 3,5-Dibromo-2-hydroxybenzoate is used in preparation of Haloarenes via Halogenation of Phenol derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 24/25-45 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
