F780721
4-(4-Nitrophenylazo)-1-naphthol , Null , 5290-62-0
Synonym(s):
4-(4-Nitrophenylazo)-1-naphthol;Magneson II
CAS NO.:5290-62-0
Empirical Formula: C16H11N3O3
Molecular Weight: 293.28
MDL number: MFCD00003975
EINECS: 226-129-4
| Pack Size | Price | Stock | Quantity |
| 10g | RMB583.20 | In Stock |
|
| 50g | RMB2144.00 | In Stock |
|
| 250g | RMB9128.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270 °C (dec.)(lit.) |
| Boiling point: | 435.13°C (rough estimate) |
| Density | 1.2211 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Store below +30°C. |
| form | Powder |
| pka | 8.19±0.40(Predicted) |
| color | Red-brown |
| BRN | 961660 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C16H11N3O3/c20-16-10-9-15(13-3-1-2-4-14(13)16)18-17-11-5-7-12(8-6-11)19(21)22/h1-10,17H/b18-15+ |
| InChIKey | UYDXOFSMBKSLPM-OBGWFSINSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)N\N=C2\c3c(cccc3)C(=O)C=C\2 |
| CAS DataBase Reference | 5290-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenol, 4-[(4-nitrophenyl)azo]- (5290-62-0) |
Description and Uses
4-(4-Nitrophenylazo)-1-naphthol is a reagent used for the determination of Mg.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,C,F |
| Risk Statements | 36/37/38-34-11 |
| Safety Statements | 22-24/25-26-36-45-36/37/39-16 |
| RIDADR | 3236 |
| WGK Germany | 3 |
| RTECS | QL4510100 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






