F793322
3-Benzyloxybenzoyl chloride , 95 , 61535-46-4
Synonym(s):
3-Benzyloxybenzoic acid chloride
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1214.40 | In Stock |
|
| 1g | RMB3848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42℃ |
| Flash point: | >110℃ |
| form | solid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C14H11ClO2/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIKey | HPVUGOBQRQUWMK-UHFFFAOYSA-N |
| SMILES | ClC(=O)c1cccc(OCc2ccccc2)c1 |
Description and Uses
Reactant for preparation of dihydroquinolinones and tetrahydroquinazolinones as potent kinesin spindle protein inhibitors and potential antitumor agents, preparation of carbamate derivatives as fatty acid amide hydrolase inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H318-H314-H400 |
| Precautionary statements | P273-P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,N |
| Risk Statements | 34-50/53 |
| Safety Statements | 26-36/37/39-45-60-61 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Skin Corr. 1B |







