PRODUCT Properties
| Melting point: | 201 °C |
| Density | 1.725 |
| refractive index | 1.6666 |
| pka | 6.91±0.20(Predicted) |
| form | powder |
| color | Yellow |
| BRN | 1536189 |
| InChI | InChI=1S/C8H3ClN2O4/c9-5-1-3-4(2-6(5)11(14)15)8(13)10-7(3)12/h1-2H,(H,10,12,13) |
| InChIKey | ADLVDYMTBOSDFE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(Cl)C([N+]([O-])=O)=C2)C(=O)N1 |
| CAS DataBase Reference | 6015-57-2(CAS DataBase Reference) |
Description and Uses
4-Chloro-5-nitropthalimide is a reagent used in the synthesis of novel benzimidazoles as antibacterial agents. Also used to prepare saludiuretic and anti-hypertensive agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
