PRODUCT Properties
| Melting point: | 28-32℃ |
| Boiling point: | 115-117 °C(Press: 20 Torr) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| form | liquid |
| color | Clear, almost colourless |
| InChI | 1S/C9H7F3OS/c1-6(13)7-2-4-8(5-3-7)14-9(10,11)12/h2-5H,1H3 |
| InChIKey | TXNFKHHYTGEPRL-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Sc1ccc(cc1)C(=O)C |
Description and Uses
4''-(Trifluoromethylthio)acetophenone is used in preparation of alpha-fluorochalcone derivatives and its application in preparation of drug for treatment of PPAR receptor-related diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| HazardClass | TOXIC |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
