PRODUCT Properties
| Melting point: | 214-217 °C(lit.) |
| Density | 1.091±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Dichloromethane, Methanol |
| form | crystals |
| pka | 11.76±0.46(Predicted) |
| BRN | 1753961 |
| InChI | InChI=1S/C4H8N2O2/c1-5-3(7)4(8)6-2/h1-2H3,(H,5,7)(H,6,8) |
| InChIKey | IPZCJUOJSODZNK-UHFFFAOYSA-N |
| SMILES | C(NC)(=O)C(NC)=O |
| CAS DataBase Reference | 615-35-0(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N'-Dimethyloxamide(615-35-0) |
Description and Uses
N,N'-Dimethyloxamide is an amide compound, mainly used in the field of organic synthesis, can be used as the preparation of imidazole drug intermediates or other heterocyclic organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
