F955822
4-(n-Nonyloxy)benzoic acid , Null , 15872-43-2
Synonym(s):
p -(Nonyloxy)benzoic acid;4-n -Nonyloxybenzoic acid
| Pack Size | Price | Stock | Quantity |
| 1g | RMB395.20 | In Stock |
|
| 5g | RMB768.00 | In Stock |
|
| 25g | RMB2957.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143 °C |
| Boiling point: | 367.59°C (rough estimate) |
| Density | 1.0468 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Store at room temperature |
| pka | 4.48±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white |
| BRN | 2213560 |
| InChI | 1S/C16H24O3/c1-2-3-4-5-6-7-8-13-19-15-11-9-14(10-12-15)16(17)18/h9-12H,2-8,13H2,1H3,(H,17,18) |
| InChIKey | BOZLUAUKDKKZHJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOc1ccc(cc1)C(O)=O |
| CAS DataBase Reference | 15872-43-2(CAS DataBase Reference) |
Description and Uses
Intermediate for the synthesis of liquid crystals including chiral ferroelectric benzoates. Used in the preparation of medicinal compounds.





