F984522
Sodium hydrogen L-tartrate , Waterless, 98 , 526-94-3
Synonym(s):
L(+)-Tartaric acid monosodium salt;Sodium bitartrate;Tartaric acid monosodium salt
CAS NO.：526-94-3
Empirical Formula: C4H5NaO6
Molecular Weight: 172.07
MDL number: MFCD00065393
EINECS: 208-400-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB204.00 | In Stock |
|
| 100g | RMB292.00 | In Stock |
|
| 500g | RMB664.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253 °C (dec.)(lit.) |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| form | Powder |
| color | White |
| optical activity | [α]20/D +24°, c = 3 in H2O |
| Water Solubility | Soluble in water. |
| Merck | 14,8589 |
| BRN | 6099125 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C4H6O6.Na/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-1/t1-,2-;/m1./s1 |
| InChIKey | NKAAEMMYHLFEFN-ZVGUSBNCSA-M |
| SMILES | [Na+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| LogP | -1.426 (est) |
| CAS DataBase Reference | 526-94-3(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, monosodium salt (526-94-3) |
Description and Uses
Mono sodium tartrate or sodium bitartrate is a sodium salt of tartaric acid. As a food additive it is used as an acidity regulator and is known by the E number E335.
Sodium hydrogen L-tartrate is used for detecting potassium and in nutrient media. It also used as a food additive and an acidity regulator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | WW8225000 |
| TSCA | TSCA listed |
| HS Code | 29181990 |
| Storage Class | 13 - Non Combustible Solids |
