LN--D-a23
2,3,5-TRI-O-BENZYL-D-ARABINOFURANOSE , 98%min , 37776-25-3
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 65-67°C |
| Boiling point: | 591.5±50.0 °C(Predicted) |
| Density | 1.175±0.06 g/cm3(Predicted) |
| storage temp. | Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Powder |
| pka | 13.28±0.20(Predicted) |
| color | White to Off-white |
| InChI | InChI=1S/C26H28O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-16,24-26,28H,17-20H2/t24-,25-,26-/m1/s1 |
| InChIKey | XUCNSIRQCBFBHF-TWJOJJKGSA-N |
| SMILES | O=C[C@H]([C@@H]([C@@H](COCC1=CC=CC=C1)O)OCC1=CC=CC=C1)OCC1=CC=CC=C1 |
Description and Uses
2,3,5-Tri-O-benzyl-D-arabinofuranose is an aldopentose sugar that functions as an intermediate in the synthesis of phosphono analog of N-acetyl-α-D-mannosamine 1-phosphate from D-arabinose.




