LN-027827
ALLANTOIC ACID , 98% , 99-16-1
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 168 °C |
| Boiling point: | 439.2±45.0 °C(Predicted) |
| Density | 1.618±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Aqueous Base (Slightly, Sonicated) |
| form | Solid |
| pka | 2.97±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) |
| InChIKey | NUCLJNSWZCHRKL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(NC(N)=O)NC(N)=O |
| CAS DataBase Reference | 99-16-1 |
| EPA Substance Registry System | Acetic acid, bis[(aminocarbonyl)amino]- (99-16-1) |
Description and Uses
Allantoic acid is used as an metabolic intermediate in nucleic acid metabolism.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2922500090 |





