LN-072930
Tetrachloropropene , 99% , 10436-39-2
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 141.38°C (rough estimate) |
| Density | 1.5500 |
| refractive index | 1.5121 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform, Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C3H2Cl4/c4-1-2(5)3(6)7/h1H2 |
| InChIKey | UMGQVBVEWTXECF-UHFFFAOYSA-N |
| SMILES | C(/Cl)(\Cl)=C(/Cl)\CCl |
| EPA Substance Registry System | 1,1,2,3-Tetrachloropropene (10436-39-2) |
Description and Uses
1,1,2,3-Tetrachloropropene is used in producing 2,3,3,3-Tetrachloropropene. 2,3,3,3-Tetrachloropropene may be useful as heat transfer compns., aerosol propellants, foaming agents, blowing agents, solvents, cleaning agents, carrier fluids, displacement drying agents, buffing abrasion agents, polymn.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| TSCA | TSCA listed |
| HS Code | 2903290000 |
| Hazardous Substances Data | 10436-39-2(Hazardous Substances Data) |
