LN-079316
Dexamethasone Impurity I , 90%+ , 14622-47-0
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >211°C |
| Boiling point: | 564.9±50.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 12.56±0.70(Predicted) |
| color | White to Pale Red |
| Major Application | pharmaceutical |
| InChIKey | GBDXNHBVYAMODG-HGBIFODKSA-N |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@]1([H])[C@]3([H])C[C@@H](C)[C@](O)(C(=O)CO)[C@@]3(C)C[C@H]3O[C@@]213 |
Description and Uses
(11α,16α)-9,11-Epoxy-17,21-dihydroxy-16-methylpregna-1,4-diene-3,20-dione, can be used for the synthesis of Calicoferol E, a vitamin D3 analogues.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| target organs | Liver,Kidney,Endocrine system |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 2 |
