LN-100216
Iso Ganciclovir , 90%+ , 86357-09-7
Update time: 2023-04-23
PRODUCT Properties
| Density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 9.34±0.20(Predicted) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-2-5(16)1-15/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17) |
| InChIKey | YMJRISBBXAOKCD-UHFFFAOYSA-N |
| SMILES | [n]1(c2nc(nc(c2nc1)O)N)COCC(O)CO |
Description and Uses
Iso Ganciclovir (Ganciclovir EP Impurity E) is an impurity of the anti-viral Gangiclovir (G235000) and Valganclovir (V092000) used in enzymatic phosphorylation studies of antiherpetic agents.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H361fd |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2933599550 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Muta. 1B Repr. 2 |
