2-BROMO-1-PHENYL-PENTAN-1-ONE , 99% , 49851-31-2
CAS NO.:49851-31-2
Empirical Formula: C11H13BrO
Molecular Weight: 241.12
MDL number: MFCD09031798
EINECS: 100-201-4
| Pack Size | Price | Stock | Quantity |
| 1KG | Inquiry | In Stock |
|
| 100Kg/Drum | USD135.00 | In Stock |
|
| 1Kg/Drum | USD150.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 94-96 °C(Press: 0.25 Torr) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C11H13BrO/c1-2-6-10(12)11(13)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1H3 |
| InChIKey | XOQFMNXQYSTQPE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)C(Br)CCC |
Description and Uses
2-Bromo-1-Phenyl-Pentan-1-One is a chemical compound with the molecular formula C11H13BrO. A bright yellow oily liquid, it boasts a boiling point of 94–96 °C (Pressure: 0.25 Torr) and a density of 1.310±0.06 g/cm3 (Predicted). Its utilization spans various scientific research applications, functioning as a reagent in organic synthesis, a foundational material in pharmaceutical synthesis, and a fundamental building block for diverse compound productions. Additionally, it has played a role in the synthesis of heterocyclic compounds like pyridines, pyrimidines, and thiophenes.
2-Bromo-1-phenyl-pentan-1-one is used in a variety of scientific research applications. It is used as a reagent in organic synthesis, as a starting material in the synthesis of pharmaceuticals, and as a building block for the production of various compounds. It has also been used in the synthesis of various heterocyclic compounds, such as pyridines, pyrimidines, and thiophenes. Additionally, 2-bromo-1-phenyl-pentan-1-one is used in the synthesis of polymers, such as polyacrylonitrile, polyvinyl chloride, and polyethylene.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P310-P332+P313-P362-P403+P233-P405-P501 |





